C6H23N2O8+ — CID 131855428
(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydron;pentahydrate (PubChem CID 131855428) has the molecular formula C6H23N2O8+ and a molecular weight of 251.26 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydron;pentahydrate.
| Compound Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydron;pentahydrate |
|---|---|
| PubChem CID | 131855428 |
| Molecular Formula | C6H23N2O8+ |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydron;pentahydrate |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)O.O.O.O.O.O.[H+] |
| InChI | InChI=1S/C6H12N2O3.5H2O/c1-3(7)5(9)8-4(2)6(10)11;;;;;/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);5*1H2/p+1/t3-,4-;;;;;/m0...../s1 |
| InChIKey | IOIFCSPSPIMDAB-GPBBXSMISA-O |
| XLogP | -5.09 |
| TPSA | 249.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |