C6H13ClN2O3 — CID 88920207
2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride (PubChem CID 88920207) has the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. Its IUPAC name is 2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 88920207 |
| Molecular Formula | C6H13ClN2O3 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride |
| SMILES | CC(NC(=O)[C@H](C)N)C(=O)O.Cl |
| InChI | InChI=1S/C6H12N2O3.ClH/c1-3(7)5(9)8-4(2)6(10)11;/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);1H/t3-,4?;/m0./s1 |
| InChIKey | YKZTXOMGFUVZSN-ZRCOPKFRSA-N |
| XLogP | -0.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |