C9H19N3O5 — CID 91872910
(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid;hydrate (PubChem CID 91872910) has the molecular formula C9H19N3O5 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid;hydrate.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid;hydrate |
|---|---|
| PubChem CID | 91872910 |
| Molecular Formula | C9H19N3O5 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid;hydrate |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O.O |
| InChI | InChI=1S/C9H17N3O4.H2O/c1-4(10)7(13)11-5(2)8(14)12-6(3)9(15)16;/h4-6H,10H2,1-3H3,(H,11,13)(H,12,14)(H,15,16);1H2/t4-,5-,6-;/m0./s1 |
| InChIKey | NQIGUUOJAGZECJ-YCLXABBFSA-N |
| XLogP | -2.40 |
| TPSA | 153.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |