C12H22N4O5S — CID 18234174
2-[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]propanoylamino]propanoic acid (PubChem CID 18234174) has the molecular formula C12H22N4O5S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 18234174 |
| Molecular Formula | C12H22N4O5S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]propanoylamino]propanoic acid |
| SMILES | CC(N)C(=O)NC(CS)C(=O)NC(C)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C12H22N4O5S/c1-5(13)9(17)16-8(4-22)11(19)14-6(2)10(18)15-7(3)12(20)21/h5-8,22H,4,13H2,1-3H3,(H,14,19)(H,15,18)(H,16,17)(H,20,21) |
| InChIKey | DWNCPAKNDOKFKH-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|