C15H28N4O5S — CID 22702537
2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 22702537) has the molecular formula C15H28N4O5S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22702537 |
| Molecular Formula | C15H28N4O5S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[[2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C)C(=O)NC(CS)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C15H28N4O5S/c1-7(2)5-10(16)13(21)17-8(3)12(20)19-11(6-25)14(22)18-9(4)15(23)24/h7-11,25H,5-6,16H2,1-4H3,(H,17,21)(H,18,22)(H,19,20)(H,23,24) |
| InChIKey | QGYDEBHSGIADNB-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|