C12H22N4O6S — CID 18232677
2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18232677) has the molecular formula C12H22N4O6S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18232677 |
| Molecular Formula | C12H22N4O6S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(CS)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C12H22N4O6S/c1-5(13)9(18)14-6(2)10(19)16-8(4-23)11(20)15-7(3-17)12(21)22/h5-8,17,23H,3-4,13H2,1-2H3,(H,14,18)(H,15,20)(H,16,19)(H,21,22) |
| InChIKey | CHHJAZBOGKXQDH-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|