C6H12N2O5 — CID 141123812
(2S)-2-[[(2R)-2-(deuterioamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 141123812) has the molecular formula C6H12N2O5 and a molecular weight of 193.18 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(deuterioamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-(deuterioamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 141123812 |
| Molecular Formula | C6H12N2O5 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | (2S)-2-[[(2R)-2-(deuterioamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | [2H]N[C@H](CO)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C6H12N2O5/c7-3(1-9)5(11)8-4(2-10)6(12)13/h3-4,9-10H,1-2,7H2,(H,8,11)(H,12,13)/t3-,4+/m1/s1/i/hD |
| InChIKey | XZKQVQKUZMAADP-XHWGBPRCSA-N |
| XLogP | -3.13 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |