C5H7Cl2NO4 — CID 44630224
(2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxypropanoic acid (PubChem CID 44630224) has the molecular formula C5H7Cl2NO4 and a molecular weight of 216.02 g/mol. Its IUPAC name is (2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 44630224 |
| Molecular Formula | C5H7Cl2NO4 |
| Molecular Weight | 216.02 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | (2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(N[C@H](CO)C(=O)O)C(Cl)Cl |
| InChI | InChI=1S/C5H7Cl2NO4/c6-3(7)4(10)8-2(1-9)5(11)12/h2-3,9H,1H2,(H,8,10)(H,11,12)/t2-/m1/s1 |
| InChIKey | POBGWTZPKSVJFM-UWTATZPHSA-N |
| XLogP | -0.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.02 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|