C7H11Cl2NO3S — CID 98566367
(2R)-2-[(2,2-dichloroacetyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 98566367) has the molecular formula C7H11Cl2NO3S and a molecular weight of 260.14 g/mol. Its IUPAC name is (2R)-2-[(2,2-dichloroacetyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(2,2-dichloroacetyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 98566367 |
| Molecular Formula | C7H11Cl2NO3S |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | (2R)-2-[(2,2-dichloroacetyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)C(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C7H11Cl2NO3S/c1-14-3-2-4(7(12)13)10-6(11)5(8)9/h4-5H,2-3H2,1H3,(H,10,11)(H,12,13)/t4-/m1/s1 |
| InChIKey | QKIZWYRQWYLDSJ-SCSAIBSYSA-N |
| XLogP | 1.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|