C8H16N2O6 — CID 61233586
2-[bis(2-hydroxyethyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 61233586) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61233586 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(CO)NC(=O)N(CCO)CCO |
| InChI | InChI=1S/C8H16N2O6/c11-3-1-10(2-4-12)8(16)9-6(5-13)7(14)15/h6,11-13H,1-5H2,(H,9,16)(H,14,15) |
| InChIKey | PLHTZGCTQXGCRL-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |