C10H20N2O7S — CID 61233958
2-[bis(2-hydroxyethyl)carbamoylamino]-4-methylsulfonylbutanoic acid (PubChem CID 61233958) has the molecular formula C10H20N2O7S and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)carbamoylamino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)carbamoylamino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 61233958 |
| Molecular Formula | C10H20N2O7S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)carbamoylamino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)N(CCO)CCO)C(=O)O |
| InChI | InChI=1S/C10H20N2O7S/c1-20(18,19)7-2-8(9(15)16)11-10(17)12(3-5-13)4-6-14/h8,13-14H,2-7H2,1H3,(H,11,17)(H,15,16) |
| InChIKey | HJLYSOMYXRJDEQ-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |