C13H24N2O5S — CID 107400162
2-[[cyclobutylmethyl(ethyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 107400162) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[[cyclobutylmethyl(ethyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[cyclobutylmethyl(ethyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 107400162 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[[cyclobutylmethyl(ethyl)carbamoyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CCN(CC1CCC1)C(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C13H24N2O5S/c1-3-15(9-10-5-4-6-10)13(18)14-11(12(16)17)7-8-21(2,19)20/h10-11H,3-9H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | PQWIAPHYTOAODU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |