C13H23NO5S — CID 43107936
2-[(2-cyclohexylacetyl)amino]-4-methylsulfonylbutanoic acid (PubChem CID 43107936) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[(2-cyclohexylacetyl)amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(2-cyclohexylacetyl)amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43107936 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(2-cyclohexylacetyl)amino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C13H23NO5S/c1-20(18,19)8-7-11(13(16)17)14-12(15)9-10-5-3-2-4-6-10/h10-11H,2-9H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | XSCBSSIJRILYHC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |