C8H16N2O5S — CID 61157970
2-[[2-(methylamino)acetyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 61157970) has the molecular formula C8H16N2O5S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-[[2-(methylamino)acetyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[2-(methylamino)acetyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 61157970 |
| Molecular Formula | C8H16N2O5S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[[2-(methylamino)acetyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CNCC(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H16N2O5S/c1-9-5-7(11)10-6(8(12)13)3-4-16(2,14)15/h6,9H,3-5H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | ZVWRUUUUGMSGPA-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |