C10H20N2O5S — CID 55121147
2-[3-(ethylamino)propanoylamino]-4-methylsulfonylbutanoic acid (PubChem CID 55121147) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[3-(ethylamino)propanoylamino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[3-(ethylamino)propanoylamino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 55121147 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[3-(ethylamino)propanoylamino]-4-methylsulfonylbutanoic acid |
| SMILES | CCNCCC(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H20N2O5S/c1-3-11-6-4-9(13)12-8(10(14)15)5-7-18(2,16)17/h8,11H,3-7H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | CYFHNHHISQSGNF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|