C11H21NO5S2 — CID 43098573
2-[(2-tert-butylsulfanylacetyl)amino]-4-methylsulfonylbutanoic acid (PubChem CID 43098573) has the molecular formula C11H21NO5S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[(2-tert-butylsulfanylacetyl)amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(2-tert-butylsulfanylacetyl)amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43098573 |
| Molecular Formula | C11H21NO5S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(2-tert-butylsulfanylacetyl)amino]-4-methylsulfonylbutanoic acid |
| SMILES | CC(C)(C)SCC(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C11H21NO5S2/c1-11(2,3)18-7-9(13)12-8(10(14)15)5-6-19(4,16)17/h8H,5-7H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | VIPSUGALACCKRI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |