C9H15F3N2O5S2 — CID 103996293
4-methylsulfonyl-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]butanoic acid (PubChem CID 103996293) has the molecular formula C9H15F3N2O5S2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 4-methylsulfonyl-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-methylsulfonyl-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 103996293 |
| Molecular Formula | C9H15F3N2O5S2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-methylsulfonyl-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]butanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)NCCSC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F3N2O5S2/c1-21(18,19)5-2-6(7(15)16)14-8(17)13-3-4-20-9(10,11)12/h6H,2-5H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | KSVFYCLCLPFYCV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|