C9H19N3O7S2 — CID 106340544
2-[2-(methylsulfamoyl)ethylcarbamoylamino]-4-methylsulfonylbutanoic acid (PubChem CID 106340544) has the molecular formula C9H19N3O7S2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[2-(methylsulfamoyl)ethylcarbamoylamino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[2-(methylsulfamoyl)ethylcarbamoylamino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 106340544 |
| Molecular Formula | C9H19N3O7S2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[2-(methylsulfamoyl)ethylcarbamoylamino]-4-methylsulfonylbutanoic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H19N3O7S2/c1-10-21(18,19)6-4-11-9(15)12-7(8(13)14)3-5-20(2,16)17/h7,10H,3-6H2,1-2H3,(H,13,14)(H2,11,12,15) |
| InChIKey | KUIWWFREGJJHIH-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |