C8H17N3O6S — CID 106340659
(2R)-4-hydroxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid (PubChem CID 106340659) has the molecular formula C8H17N3O6S and a molecular weight of 283.31 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 106340659 |
| Molecular Formula | C8H17N3O6S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2R)-4-hydroxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C8H17N3O6S/c1-9-18(16,17)5-3-10-8(15)11-6(2-4-12)7(13)14/h6,9,12H,2-5H2,1H3,(H,13,14)(H2,10,11,15)/t6-/m1/s1 |
| InChIKey | YKOOEGXBVZIPFY-ZCFIWIBFSA-N |
| XLogP | -2.33 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |