C9H19N3O6S — CID 106340386
(2R)-4-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid (PubChem CID 106340386) has the molecular formula C9H19N3O6S and a molecular weight of 297.33 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 106340386 |
| Molecular Formula | C9H19N3O6S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2R)-4-hydroxy-2-[3-(methanesulfonamido)propylcarbamoylamino]butanoic acid |
| SMILES | CS(=O)(=O)NCCCNC(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C9H19N3O6S/c1-19(17,18)11-5-2-4-10-9(16)12-7(3-6-13)8(14)15/h7,11,13H,2-6H2,1H3,(H,14,15)(H2,10,12,16)/t7-/m1/s1 |
| InChIKey | GUCMSZRYUBKMNS-SSDOTTSWSA-N |
| XLogP | -1.94 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|