C9H18N4O6S — CID 106340374
(2R)-4-amino-2-[3-(methanesulfonamido)propylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 106340374) has the molecular formula C9H18N4O6S and a molecular weight of 310.33 g/mol. Its IUPAC name is (2R)-4-amino-2-[3-(methanesulfonamido)propylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[3-(methanesulfonamido)propylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106340374 |
| Molecular Formula | C9H18N4O6S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2R)-4-amino-2-[3-(methanesulfonamido)propylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)NCCCNC(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H18N4O6S/c1-20(18,19)12-4-2-3-11-9(17)13-6(8(15)16)5-7(10)14/h6,12H,2-5H2,1H3,(H2,10,14)(H,15,16)(H2,11,13,17)/t6-/m1/s1 |
| InChIKey | UPTOYMMPGXFVEZ-ZCFIWIBFSA-N |
| XLogP | -2.45 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|