C10H19N3O5S — CID 106340387
2-[3-(methanesulfonamido)propylcarbamoylamino]pent-4-enoic acid (PubChem CID 106340387) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylcarbamoylamino]pent-4-enoic acid.
| Compound Name | 2-[3-(methanesulfonamido)propylcarbamoylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 106340387 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylcarbamoylamino]pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)NCCCNS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5S/c1-3-5-8(9(14)15)13-10(16)11-6-4-7-12-19(2,17)18/h3,8,12H,1,4-7H2,2H3,(H,14,15)(H2,11,13,16) |
| InChIKey | XKLCGMYDBPIOBQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|