C11H20N2O5 — CID 114101302
2-(2,3-dimethoxypropylcarbamoylamino)pent-4-enoic acid (PubChem CID 114101302) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-(2,3-dimethoxypropylcarbamoylamino)pent-4-enoic acid.
| Compound Name | 2-(2,3-dimethoxypropylcarbamoylamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 114101302 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(2,3-dimethoxypropylcarbamoylamino)pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)NCC(COC)OC)C(=O)O |
| InChI | InChI=1S/C11H20N2O5/c1-4-5-9(10(14)15)13-11(16)12-6-8(18-3)7-17-2/h4,8-9H,1,5-7H2,2-3H3,(H,14,15)(H2,12,13,16) |
| InChIKey | HSGCSHFVNUPKKF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|