C12H24N2O5 — CID 114101270
5-(2,3-dimethoxypropylcarbamoylamino)hexanoic acid (PubChem CID 114101270) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is 5-(2,3-dimethoxypropylcarbamoylamino)hexanoic acid.
| Compound Name | 5-(2,3-dimethoxypropylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114101270 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 5-(2,3-dimethoxypropylcarbamoylamino)hexanoic acid |
| SMILES | COCC(CNC(=O)NC(C)CCCC(=O)O)OC |
| InChI | InChI=1S/C12H24N2O5/c1-9(5-4-6-11(15)16)14-12(17)13-7-10(19-3)8-18-2/h9-10H,4-8H2,1-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | DAFSNZLFQOVIGB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |