C7H14O2 — CID 73040162
4,5-dimethoxypent-1-ene (PubChem CID 73040162) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is 4,5-dimethoxypent-1-ene.
| Compound Name | 4,5-dimethoxypent-1-ene |
|---|---|
| PubChem CID | 73040162 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 4,5-dimethoxypent-1-ene |
| SMILES | C=CCC(COC)OC |
| InChI | InChI=1S/C7H14O2/c1-4-5-7(9-3)6-8-2/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | XGEJXRXJBXZUGJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|