C14H26O2 — CID 88561855
4-(6-methoxyhexoxy)hepta-1,6-diene (PubChem CID 88561855) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-(6-methoxyhexoxy)hepta-1,6-diene.
| Compound Name | 4-(6-methoxyhexoxy)hepta-1,6-diene |
|---|---|
| PubChem CID | 88561855 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 4-(6-methoxyhexoxy)hepta-1,6-diene |
| SMILES | C=CCC(CC=C)OCCCCCCOC |
| InChI | InChI=1S/C14H26O2/c1-4-10-14(11-5-2)16-13-9-7-6-8-12-15-3/h4-5,14H,1-2,6-13H2,3H3 |
| InChIKey | CSEOGYMIXOMSQO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|