About 3-(3-methoxypropoxy)penta-1,4-diene
3-(3-methoxypropoxy)penta-1,4-diene (PubChem CID 88561870) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-(3-methoxypropoxy)penta-1,4-diene.
Molecular Properties
| Compound Name | 3-(3-methoxypropoxy)penta-1,4-diene |
| PubChem CID | 88561870 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-(3-methoxypropoxy)penta-1,4-diene |
| SMILES | C=CC(C=C)OCCCOC |
| InChI | InChI=1S/C9H16O2/c1-4-9(5-2)11-8-6-7-10-3/h4-5,9H,1-2,6-8H2,3H3 |
| InChIKey | UTLKMAFPMOJIBF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methoxypropoxy)penta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxypropoxy)penta-1,4-diene?
The IUPAC name of 3-(3-methoxypropoxy)penta-1,4-diene (CID 88561870) is 3-(3-methoxypropoxy)penta-1,4-diene.
What is the SMILES notation for 3-(3-methoxypropoxy)penta-1,4-diene?
The canonical SMILES for 3-(3-methoxypropoxy)penta-1,4-diene is C=CC(C=C)OCCCOC.
What is the InChIKey of 3-(3-methoxypropoxy)penta-1,4-diene?
The InChIKey is UTLKMAFPMOJIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-9(5-2)11-8-6-7-10-3/h4-5,9H,1-2,6-8H2,3H3.
What are the key properties of 3-(3-methoxypropoxy)penta-1,4-diene?
3-(3-methoxypropoxy)penta-1,4-diene has a molecular weight of 156.22 g/mol, XLogP of 1.78, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxypropoxy)penta-1,4-diene is sourced from PubChem (CID 88561870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).