C9H16O2 — CID 88561870
3-(3-methoxypropoxy)penta-1,4-diene (PubChem CID 88561870) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-(3-methoxypropoxy)penta-1,4-diene.
| Compound Name | 3-(3-methoxypropoxy)penta-1,4-diene |
|---|---|
| PubChem CID | 88561870 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-(3-methoxypropoxy)penta-1,4-diene |
| SMILES | C=CC(C=C)OCCCOC |
| InChI | InChI=1S/C9H16O2/c1-4-9(5-2)11-8-6-7-10-3/h4-5,9H,1-2,6-8H2,3H3 |
| InChIKey | UTLKMAFPMOJIBF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|