C12H24O6 — CID 175711628
1-(3-methoxypropoxy)-2,2-dimethylpropane-1,3-diol;prop-2-enoic acid (PubChem CID 175711628) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(3-methoxypropoxy)-2,2-dimethylpropane-1,3-diol;prop-2-enoic acid.
| Compound Name | 1-(3-methoxypropoxy)-2,2-dimethylpropane-1,3-diol;prop-2-enoic acid |
|---|---|
| PubChem CID | 175711628 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(3-methoxypropoxy)-2,2-dimethylpropane-1,3-diol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.COCCCOC(O)C(C)(C)CO |
| InChI | InChI=1S/C9H20O4.C3H4O2/c1-9(2,7-10)8(11)13-6-4-5-12-3;1-2-3(4)5/h8,10-11H,4-7H2,1-3H3;2H,1H2,(H,4,5) |
| InChIKey | HAPFVCIUIWLMFO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|