C10H20O10 — CID 175271048
2-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]ethane-1,1,1,2-tetrol;prop-2-enoic acid (PubChem CID 175271048) has the molecular formula C10H20O10 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]ethane-1,1,1,2-tetrol;prop-2-enoic acid.
| Compound Name | 2-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]ethane-1,1,1,2-tetrol;prop-2-enoic acid |
|---|---|
| PubChem CID | 175271048 |
| Molecular Formula | C10H20O10 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]ethane-1,1,1,2-tetrol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.OCC(CO)(CO)COC(O)C(O)(O)O |
| InChI | InChI=1S/C7H16O8.C3H4O2/c8-1-6(2-9,3-10)4-15-5(11)7(12,13)14;1-2-3(4)5/h5,8-14H,1-4H2;2H,1H2,(H,4,5) |
| InChIKey | FQWVHLQCWCBMEO-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|