C8H19O10P — CID 175094924
2,2-bis(hydroxymethyl)propane-1,3-diol;phosphoric acid;prop-2-enoic acid (PubChem CID 175094924) has the molecular formula C8H19O10P and a molecular weight of 306.20 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;phosphoric acid;prop-2-enoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;phosphoric acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 175094924 |
| Molecular Formula | C8H19O10P |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;phosphoric acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=P(O)(O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C3H4O2.H3O4P/c6-1-5(2-7,3-8)4-9;1-2-3(4)5;1-5(2,3)4/h6-9H,1-4H2;2H,1H2,(H,4,5);(H3,1,2,3,4) |
| InChIKey | ZTYOMASKEMZBCY-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|