C11H25O10P — CID 174679316
2,2-bis(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid;trimethyl phosphate (PubChem CID 174679316) has the molecular formula C11H25O10P and a molecular weight of 348.29 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid;trimethyl phosphate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid;trimethyl phosphate |
|---|---|
| PubChem CID | 174679316 |
| Molecular Formula | C11H25O10P |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid;trimethyl phosphate |
| SMILES | C=CC(=O)O.COP(=O)(OC)OC.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C3H9O4P.C3H4O2/c6-1-5(2-7,3-8)4-9;1-5-8(4,6-2)7-3;1-2-3(4)5/h6-9H,1-4H2;1-3H3;2H,1H2,(H,4,5) |
| InChIKey | IUEDBZFKMSQYLL-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|