About (3S)-3,4-dimethoxybutanal
(3S)-3,4-dimethoxybutanal (PubChem CID 11535563) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is (3S)-3,4-dimethoxybutanal.
Molecular Properties
| Compound Name | (3S)-3,4-dimethoxybutanal |
| PubChem CID | 11535563 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (3S)-3,4-dimethoxybutanal |
| SMILES | COC[C@H](CC=O)OC |
| InChI | InChI=1S/C6H12O3/c1-8-5-6(9-2)3-4-7/h4,6H,3,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | QTOGOWCQVDATLL-LURJTMIESA-N |
| XLogP | 0.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,4-dimethoxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,4-dimethoxybutanal?
The IUPAC name of (3S)-3,4-dimethoxybutanal (CID 11535563) is (3S)-3,4-dimethoxybutanal.
What is the SMILES notation for (3S)-3,4-dimethoxybutanal?
The canonical SMILES for (3S)-3,4-dimethoxybutanal is COC[C@H](CC=O)OC.
What is the InChIKey of (3S)-3,4-dimethoxybutanal?
The InChIKey is QTOGOWCQVDATLL-LURJTMIESA-N. The full InChI is InChI=1S/C6H12O3/c1-8-5-6(9-2)3-4-7/h4,6H,3,5H2,1-2H3/t6-/m0/s1.
What are the key properties of (3S)-3,4-dimethoxybutanal?
(3S)-3,4-dimethoxybutanal has a molecular weight of 132.16 g/mol, XLogP of 0.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,4-dimethoxybutanal is sourced from PubChem (CID 11535563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).