C6H12O3 — CID 11535563
(3S)-3,4-dimethoxybutanal (PubChem CID 11535563) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (3S)-3,4-dimethoxybutanal.
| Compound Name | (3S)-3,4-dimethoxybutanal |
|---|---|
| PubChem CID | 11535563 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (3S)-3,4-dimethoxybutanal |
| SMILES | COC[C@H](CC=O)OC |
| InChI | InChI=1S/C6H12O3/c1-8-5-6(9-2)3-4-7/h4,6H,3,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | QTOGOWCQVDATLL-LURJTMIESA-N |
| XLogP | 0.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|