About (2S)-2,3-dimethoxypropane-1-thiol
(2S)-2,3-dimethoxypropane-1-thiol (PubChem CID 6540412) has the molecular formula C5H12O2S
and a molecular weight of 136.22 g/mol. Its IUPAC name is (2S)-2,3-dimethoxypropane-1-thiol.
Molecular Properties
| Compound Name | (2S)-2,3-dimethoxypropane-1-thiol |
| PubChem CID | 6540412 |
| Molecular Formula | C5H12O2S |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | (2S)-2,3-dimethoxypropane-1-thiol |
| SMILES | COC[C@@H](CS)OC |
| InChI | InChI=1S/C5H12O2S/c1-6-3-5(4-8)7-2/h5,8H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | DHPWFCPTNNKRTI-YFKPBYRVSA-N |
| XLogP | 0.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,3-dimethoxypropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dimethoxypropane-1-thiol?
The IUPAC name of (2S)-2,3-dimethoxypropane-1-thiol (CID 6540412) is (2S)-2,3-dimethoxypropane-1-thiol.
What is the SMILES notation for (2S)-2,3-dimethoxypropane-1-thiol?
The canonical SMILES for (2S)-2,3-dimethoxypropane-1-thiol is COC[C@@H](CS)OC.
What is the InChIKey of (2S)-2,3-dimethoxypropane-1-thiol?
The InChIKey is DHPWFCPTNNKRTI-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H12O2S/c1-6-3-5(4-8)7-2/h5,8H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of (2S)-2,3-dimethoxypropane-1-thiol?
(2S)-2,3-dimethoxypropane-1-thiol has a molecular weight of 136.22 g/mol, XLogP of 0.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dimethoxypropane-1-thiol is sourced from PubChem (CID 6540412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).