C9H20O2 — CID 123627097
1,2-dimethoxy-4-methylhexane (PubChem CID 123627097) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1,2-dimethoxy-4-methylhexane.
| Compound Name | 1,2-dimethoxy-4-methylhexane |
|---|---|
| PubChem CID | 123627097 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 1,2-dimethoxy-4-methylhexane |
| SMILES | CCC(C)CC(COC)OC |
| InChI | InChI=1S/C9H20O2/c1-5-8(2)6-9(11-4)7-10-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | ZBXWMFVXJHBWQU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |