About methane;1-methoxy-2-methylbutane
methane;1-methoxy-2-methylbutane (PubChem CID 159281556) has the molecular formula C10H30O
and a molecular weight of 166.35 g/mol. Its IUPAC name is methane;1-methoxy-2-methylbutane.
Molecular Properties
| Compound Name | methane;1-methoxy-2-methylbutane |
| PubChem CID | 159281556 |
| Molecular Formula | C10H30O |
| Molecular Weight | 166.35 g/mol |
| Exact Mass | 166.23 |
| IUPAC Name | methane;1-methoxy-2-methylbutane |
| SMILES | C.C.C.C.CCC(C)COC |
| InChI | InChI=1S/C6H14O.4CH4/c1-4-6(2)5-7-3;;;;/h6H,4-5H2,1-3H3;4*1H4 |
| InChIKey | KYZCPAXTUGFCSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;1-methoxy-2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxy-2-methylbutane?
The IUPAC name of methane;1-methoxy-2-methylbutane (CID 159281556) is methane;1-methoxy-2-methylbutane.
What is the SMILES notation for methane;1-methoxy-2-methylbutane?
The canonical SMILES for methane;1-methoxy-2-methylbutane is C.C.C.C.CCC(C)COC.
What is the InChIKey of methane;1-methoxy-2-methylbutane?
The InChIKey is KYZCPAXTUGFCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.4CH4/c1-4-6(2)5-7-3;;;;/h6H,4-5H2,1-3H3;4*1H4.
What are the key properties of methane;1-methoxy-2-methylbutane?
methane;1-methoxy-2-methylbutane has a molecular weight of 166.35 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxy-2-methylbutane is sourced from PubChem (CID 159281556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).