About ethane;1-methoxy-2-methylbutane;propane
ethane;1-methoxy-2-methylbutane;propane (PubChem CID 143686071) has the molecular formula C11H28O
and a molecular weight of 176.34 g/mol. Its IUPAC name is ethane;1-methoxy-2-methylbutane;propane.
Molecular Properties
| Compound Name | ethane;1-methoxy-2-methylbutane;propane |
| PubChem CID | 143686071 |
| Molecular Formula | C11H28O |
| Molecular Weight | 176.34 g/mol |
| Exact Mass | 176.21 |
| IUPAC Name | ethane;1-methoxy-2-methylbutane;propane |
| SMILES | CC.CCC.CCC(C)COC |
| InChI | InChI=1S/C6H14O.C3H8.C2H6/c1-4-6(2)5-7-3;1-3-2;1-2/h6H,4-5H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | UVCRHYRLOWCVIY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methoxy-2-methylbutane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-2-methylbutane;propane?
The IUPAC name of ethane;1-methoxy-2-methylbutane;propane (CID 143686071) is ethane;1-methoxy-2-methylbutane;propane.
What is the SMILES notation for ethane;1-methoxy-2-methylbutane;propane?
The canonical SMILES for ethane;1-methoxy-2-methylbutane;propane is CC.CCC.CCC(C)COC.
What is the InChIKey of ethane;1-methoxy-2-methylbutane;propane?
The InChIKey is UVCRHYRLOWCVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C3H8.C2H6/c1-4-6(2)5-7-3;1-3-2;1-2/h6H,4-5H2,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methoxy-2-methylbutane;propane?
ethane;1-methoxy-2-methylbutane;propane has a molecular weight of 176.34 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-2-methylbutane;propane is sourced from PubChem (CID 143686071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).