About ethane;3-methylpentane
ethane;3-methylpentane (PubChem CID 91147782) has the molecular formula C8H20
and a molecular weight of 116.25 g/mol. Its IUPAC name is ethane;3-methylpentane.
Molecular Properties
| Compound Name | ethane;3-methylpentane |
| PubChem CID | 91147782 |
| Molecular Formula | C8H20 |
| Molecular Weight | 116.25 g/mol |
| Exact Mass | 116.16 |
| IUPAC Name | ethane;3-methylpentane |
| SMILES | CC.CCC(C)CC |
| InChI | InChI=1S/C6H14.C2H6/c1-4-6(3)5-2;1-2/h6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | RSLWYWHVRGRLGW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylpentane?
The IUPAC name of ethane;3-methylpentane (CID 91147782) is ethane;3-methylpentane.
What is the SMILES notation for ethane;3-methylpentane?
The canonical SMILES for ethane;3-methylpentane is CC.CCC(C)CC.
What is the InChIKey of ethane;3-methylpentane?
The InChIKey is RSLWYWHVRGRLGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C2H6/c1-4-6(3)5-2;1-2/h6H,4-5H2,1-3H3;1-2H3.
What are the key properties of ethane;3-methylpentane?
ethane;3-methylpentane has a molecular weight of 116.25 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylpentane is sourced from PubChem (CID 91147782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).