About 3-methylpentane;hydrate
3-methylpentane;hydrate (PubChem CID 144914279) has the molecular formula C6H16O
and a molecular weight of 104.19 g/mol. Its IUPAC name is 3-methylpentane;hydrate.
Molecular Properties
| Compound Name | 3-methylpentane;hydrate |
| PubChem CID | 144914279 |
| Molecular Formula | C6H16O |
| Molecular Weight | 104.19 g/mol |
| Exact Mass | 104.12 |
| IUPAC Name | 3-methylpentane;hydrate |
| SMILES | CCC(C)CC.O |
| InChI | InChI=1S/C6H14.H2O/c1-4-6(3)5-2;/h6H,4-5H2,1-3H3;1H2 |
| InChIKey | PJCDVWANMOLSHF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylpentane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentane;hydrate?
The IUPAC name of 3-methylpentane;hydrate (CID 144914279) is 3-methylpentane;hydrate.
What is the SMILES notation for 3-methylpentane;hydrate?
The canonical SMILES for 3-methylpentane;hydrate is CCC(C)CC.O.
What is the InChIKey of 3-methylpentane;hydrate?
The InChIKey is PJCDVWANMOLSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.H2O/c1-4-6(3)5-2;/h6H,4-5H2,1-3H3;1H2.
What are the key properties of 3-methylpentane;hydrate?
3-methylpentane;hydrate has a molecular weight of 104.19 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentane;hydrate is sourced from PubChem (CID 144914279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).