About isocyanic acid;methane;3-methylpentane
isocyanic acid;methane;3-methylpentane (PubChem CID 174793892) has the molecular formula C13H36N2O2
and a molecular weight of 252.44 g/mol. Its IUPAC name is isocyanic acid;methane;3-methylpentane.
Molecular Properties
| Compound Name | isocyanic acid;methane;3-methylpentane |
| PubChem CID | 174793892 |
| Molecular Formula | C13H36N2O2 |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | isocyanic acid;methane;3-methylpentane |
| SMILES | C.C.C.C.C.CCC(C)CC.N=C=O.N=C=O |
| InChI | InChI=1S/C6H14.2CHNO.5CH4/c1-4-6(3)5-2;2*2-1-3;;;;;/h6H,4-5H2,1-3H3;2*2H;5*1H4 |
| InChIKey | JWKHYFNAVXDDOI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;methane;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;methane;3-methylpentane?
The IUPAC name of isocyanic acid;methane;3-methylpentane (CID 174793892) is isocyanic acid;methane;3-methylpentane.
What is the SMILES notation for isocyanic acid;methane;3-methylpentane?
The canonical SMILES for isocyanic acid;methane;3-methylpentane is C.C.C.C.C.CCC(C)CC.N=C=O.N=C=O.
What is the InChIKey of isocyanic acid;methane;3-methylpentane?
The InChIKey is JWKHYFNAVXDDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.2CHNO.5CH4/c1-4-6(3)5-2;2*2-1-3;;;;;/h6H,4-5H2,1-3H3;2*2H;5*1H4.
What are the key properties of isocyanic acid;methane;3-methylpentane?
isocyanic acid;methane;3-methylpentane has a molecular weight of 252.44 g/mol, XLogP of 5.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;methane;3-methylpentane is sourced from PubChem (CID 174793892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).