About carbonic acid;3-methylpentane
carbonic acid;3-methylpentane (PubChem CID 173481374) has the molecular formula C9H20O9
and a molecular weight of 272.25 g/mol. Its IUPAC name is carbonic acid;3-methylpentane.
Molecular Properties
| Compound Name | carbonic acid;3-methylpentane |
| PubChem CID | 173481374 |
| Molecular Formula | C9H20O9 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | carbonic acid;3-methylpentane |
| SMILES | CCC(C)CC.O=C(O)O.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C6H14.3CH2O3/c1-4-6(3)5-2;3*2-1(3)4/h6H,4-5H2,1-3H3;3*(H2,2,3,4) |
| InChIKey | CGPYCXWHCNHIKV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;3-methylpentane?
The IUPAC name of carbonic acid;3-methylpentane (CID 173481374) is carbonic acid;3-methylpentane.
What is the SMILES notation for carbonic acid;3-methylpentane?
The canonical SMILES for carbonic acid;3-methylpentane is CCC(C)CC.O=C(O)O.O=C(O)O.O=C(O)O.
What is the InChIKey of carbonic acid;3-methylpentane?
The InChIKey is CGPYCXWHCNHIKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.3CH2O3/c1-4-6(3)5-2;3*2-1(3)4/h6H,4-5H2,1-3H3;3*(H2,2,3,4).
What are the key properties of carbonic acid;3-methylpentane?
carbonic acid;3-methylpentane has a molecular weight of 272.25 g/mol, XLogP of 3.11, 2 rotatable bonds, 6 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;3-methylpentane is sourced from PubChem (CID 173481374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).