About 3-methylpentane;propane
3-methylpentane;propane (PubChem CID 123266773) has the molecular formula C9H22
and a molecular weight of 130.27 g/mol. Its IUPAC name is 3-methylpentane;propane.
Molecular Properties
| Compound Name | 3-methylpentane;propane |
| PubChem CID | 123266773 |
| Molecular Formula | C9H22 |
| Molecular Weight | 130.27 g/mol |
| Exact Mass | 130.17 |
| IUPAC Name | 3-methylpentane;propane |
| SMILES | CCC.CCC(C)CC |
| InChI | InChI=1S/C6H14.C3H8/c1-4-6(3)5-2;1-3-2/h6H,4-5H2,1-3H3;3H2,1-2H3 |
| InChIKey | DEKYTJFUGJPQKW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylpentane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentane;propane?
The IUPAC name of 3-methylpentane;propane (CID 123266773) is 3-methylpentane;propane.
What is the SMILES notation for 3-methylpentane;propane?
The canonical SMILES for 3-methylpentane;propane is CCC.CCC(C)CC.
What is the InChIKey of 3-methylpentane;propane?
The InChIKey is DEKYTJFUGJPQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C3H8/c1-4-6(3)5-2;1-3-2/h6H,4-5H2,1-3H3;3H2,1-2H3.
What are the key properties of 3-methylpentane;propane?
3-methylpentane;propane has a molecular weight of 130.27 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentane;propane is sourced from PubChem (CID 123266773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).