C12H28 — CID 145235091
2,5-dimethylheptane;propane (PubChem CID 145235091) has the molecular formula C12H28 and a molecular weight of 172.36 g/mol. Its IUPAC name is 2,5-dimethylheptane;propane.
| Compound Name | 2,5-dimethylheptane;propane |
|---|---|
| PubChem CID | 145235091 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | 2,5-dimethylheptane;propane |
| SMILES | CCC.CCC(C)CCC(C)C |
| InChI | InChI=1S/C9H20.C3H8/c1-5-9(4)7-6-8(2)3;1-3-2/h8-9H,5-7H2,1-4H3;3H2,1-2H3 |
| InChIKey | POKUNNBXVJMTGK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |