C18H40 — CID 143901344
ethane;3,6,7,10-tetramethyldodecane (PubChem CID 143901344) has the molecular formula C18H40 and a molecular weight of 256.52 g/mol. Its IUPAC name is ethane;3,6,7,10-tetramethyldodecane.
| Compound Name | ethane;3,6,7,10-tetramethyldodecane |
|---|---|
| PubChem CID | 143901344 |
| Molecular Formula | C18H40 |
| Molecular Weight | 256.52 g/mol |
| Exact Mass | 256.31 |
| IUPAC Name | ethane;3,6,7,10-tetramethyldodecane |
| SMILES | CC.CCC(C)CCC(C)C(C)CCC(C)CC |
| InChI | InChI=1S/C16H34.C2H6/c1-7-13(3)9-11-15(5)16(6)12-10-14(4)8-2;1-2/h13-16H,7-12H2,1-6H3;1-2H3 |
| InChIKey | FXVAFEVFYYHCRQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.52 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |