C27H60 — CID 161182355
3,5-dimethylheptane;3,4-dimethylhexane;3,6-dimethyloctane (PubChem CID 161182355) has the molecular formula C27H60 and a molecular weight of 384.78 g/mol. Its IUPAC name is 3,5-dimethylheptane;3,4-dimethylhexane;3,6-dimethyloctane.
| Compound Name | 3,5-dimethylheptane;3,4-dimethylhexane;3,6-dimethyloctane |
|---|---|
| PubChem CID | 161182355 |
| Molecular Formula | C27H60 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.47 |
| IUPAC Name | 3,5-dimethylheptane;3,4-dimethylhexane;3,6-dimethyloctane |
| SMILES | CCC(C)C(C)CC.CCC(C)CC(C)CC.CCC(C)CCC(C)CC |
| InChI | InChI=1S/C10H22.C9H20.C8H18/c1-5-9(3)7-8-10(4)6-2;1-5-8(3)7-9(4)6-2;1-5-7(3)8(4)6-2/h9-10H,5-8H2,1-4H3;8-9H,5-7H2,1-4H3;7-8H,5-6H2,1-4H3 |
| InChIKey | USQBJPSNKISWMF-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |