C17H36 — CID 145154511
prop-1-ene;3,6,7-trimethylundecane (PubChem CID 145154511) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is prop-1-ene;3,6,7-trimethylundecane.
| Compound Name | prop-1-ene;3,6,7-trimethylundecane |
|---|---|
| PubChem CID | 145154511 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | prop-1-ene;3,6,7-trimethylundecane |
| SMILES | C=CC.CCCCC(C)C(C)CCC(C)CC |
| InChI | InChI=1S/C14H30.C3H6/c1-6-8-9-13(4)14(5)11-10-12(3)7-2;1-3-2/h12-14H,6-11H2,1-5H3;3H,1H2,2H3 |
| InChIKey | VLHCHHICLIRGPM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|