C13H28 — CID 154723790
(5S,6R)-2,5,6-trimethyldecane (PubChem CID 154723790) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is (5S,6R)-2,5,6-trimethyldecane.
| Compound Name | (5S,6R)-2,5,6-trimethyldecane |
|---|---|
| PubChem CID | 154723790 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | (5S,6R)-2,5,6-trimethyldecane |
| SMILES | CCCC[C@@H](C)[C@@H](C)CCC(C)C |
| InChI | InChI=1S/C13H28/c1-6-7-8-12(4)13(5)10-9-11(2)3/h11-13H,6-10H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | HBEWRUSPWIMDCH-OLZOCXBDSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |