C22H46 — CID 14870619
(10S,11S)-10,11-dimethylicosane (PubChem CID 14870619) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is (10S,11S)-10,11-dimethylicosane.
| Compound Name | (10S,11S)-10,11-dimethylicosane |
|---|---|
| PubChem CID | 14870619 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | (10S,11S)-10,11-dimethylicosane |
| SMILES | CCCCCCCCC[C@H](C)[C@@H](C)CCCCCCCCC |
| InChI | InChI=1S/C22H46/c1-5-7-9-11-13-15-17-19-21(3)22(4)20-18-16-14-12-10-8-6-2/h21-22H,5-20H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | FQUKLYIORXDPRI-VXKWHMMOSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|