About 11,12-dimethyltricosane
11,12-dimethyltricosane (PubChem CID 173430605) has the molecular formula C25H52
and a molecular weight of 352.69 g/mol. Its IUPAC name is 11,12-dimethyltricosane.
Molecular Properties
| Compound Name | 11,12-dimethyltricosane |
| PubChem CID | 173430605 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 11,12-dimethyltricosane |
| SMILES | CCCCCCCCCCCC(C)C(C)CCCCCCCCCC |
| InChI | InChI=1S/C25H52/c1-5-7-9-11-13-15-17-19-21-23-25(4)24(3)22-20-18-16-14-12-10-8-6-2/h24-25H,5-23H2,1-4H3 |
| InChIKey | KUXXWSACHTUEHB-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11,12-dimethyltricosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,12-dimethyltricosane?
The IUPAC name of 11,12-dimethyltricosane (CID 173430605) is 11,12-dimethyltricosane.
What is the SMILES notation for 11,12-dimethyltricosane?
The canonical SMILES for 11,12-dimethyltricosane is CCCCCCCCCCCC(C)C(C)CCCCCCCCCC.
What is the InChIKey of 11,12-dimethyltricosane?
The InChIKey is KUXXWSACHTUEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H52/c1-5-7-9-11-13-15-17-19-21-23-25(4)24(3)22-20-18-16-14-12-10-8-6-2/h24-25H,5-23H2,1-4H3.
What are the key properties of 11,12-dimethyltricosane?
11,12-dimethyltricosane has a molecular weight of 352.69 g/mol, XLogP of 9.71, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11,12-dimethyltricosane is sourced from PubChem (CID 173430605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).