C25H52 — CID 123460288
2,3,14,15-tetramethylhenicosane (PubChem CID 123460288) has the molecular formula C25H52 and a molecular weight of 352.69 g/mol. Its IUPAC name is 2,3,14,15-tetramethylhenicosane.
| Compound Name | 2,3,14,15-tetramethylhenicosane |
|---|---|
| PubChem CID | 123460288 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 2,3,14,15-tetramethylhenicosane |
| SMILES | CCCCCCC(C)C(C)CCCCCCCCCCC(C)C(C)C |
| InChI | InChI=1S/C25H52/c1-7-8-9-16-20-24(5)25(6)21-18-15-13-11-10-12-14-17-19-23(4)22(2)3/h22-25H,7-21H2,1-6H3 |
| InChIKey | QIOKCOLKCCBKKZ-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|