About alumane;2,3-dimethylheptane
alumane;2,3-dimethylheptane (PubChem CID 174508099) has the molecular formula C9H23Al
and a molecular weight of 158.26 g/mol. Its IUPAC name is alumane;2,3-dimethylheptane.
Molecular Properties
| Compound Name | alumane;2,3-dimethylheptane |
| PubChem CID | 174508099 |
| Molecular Formula | C9H23Al |
| Molecular Weight | 158.26 g/mol |
| Exact Mass | 158.16 |
| IUPAC Name | alumane;2,3-dimethylheptane |
| SMILES | CCCCC(C)C(C)C.[AlH3] |
| InChI | InChI=1S/C9H20.Al.3H/c1-5-6-7-9(4)8(2)3;;;;/h8-9H,5-7H2,1-4H3;;;; |
| InChIKey | DHHNDJKYSRHHIR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze alumane;2,3-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2,3-dimethylheptane?
The IUPAC name of alumane;2,3-dimethylheptane (CID 174508099) is alumane;2,3-dimethylheptane.
What is the SMILES notation for alumane;2,3-dimethylheptane?
The canonical SMILES for alumane;2,3-dimethylheptane is CCCCC(C)C(C)C.[AlH3].
What is the InChIKey of alumane;2,3-dimethylheptane?
The InChIKey is DHHNDJKYSRHHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.Al.3H/c1-5-6-7-9(4)8(2)3;;;;/h8-9H,5-7H2,1-4H3;;;;.
What are the key properties of alumane;2,3-dimethylheptane?
alumane;2,3-dimethylheptane has a molecular weight of 158.26 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2,3-dimethylheptane is sourced from PubChem (CID 174508099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).